5-(4-Pyridyl)-1H-1,2,4-triazol-3(2H)-one structure
|
Common Name | 5-(4-Pyridyl)-1H-1,2,4-triazol-3(2H)-one | ||
|---|---|---|---|---|
| CAS Number | 939-08-2 | Molecular Weight | 162.14900 | |
| Density | 1.55g/cm3 | Boiling Point | 508.9ºC at 760 mmHg | |
| Molecular Formula | C7H6N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 261.6ºC | |
| Name | 5-pyridin-4-yl-1,2-dihydro-1,2,4-triazol-3-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.55g/cm3 |
|---|---|
| Boiling Point | 508.9ºC at 760 mmHg |
| Molecular Formula | C7H6N4O |
| Molecular Weight | 162.14900 |
| Flash Point | 261.6ºC |
| Exact Mass | 162.05400 |
| PSA | 74.69000 |
| LogP | 0.57230 |
| Index of Refraction | 1.756 |
| InChIKey | UKPXYDJSESBHPR-UHFFFAOYSA-N |
| SMILES | O=c1[nH]nc(-c2ccncc2)[nH]1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Pyridine,4-(3-hydroxy-4H-1,2,4-triazol-5-yl) |
| 5-[4]pyridyl-1,2-dihydro-[1,2,4]triazol-3-one |
| 5-(4-Pyridyl)-1H-1,2,4-triazol-3(2H)-one |
| 5-(pyridin-4-yl)-1,2-dihydro-3h-1,2,4-triazol-3-one |
| 4-(3-HYDROXY-4H-1,2,4-TRIAZOL-5-YL)PYRIDINE |
| 3-(Pyridin-4-yl)-1H-1,2,4-triazol-5(4H)-one |
| 4H-1,2,4-Triazol-3-ol,5-(4-pyridyl) |
| 3-Hydroxy-5-(4-pyridyl)-1,2,4(H)-triazole |