Isopropyl 1H-indole-3-propionate structure
|
Common Name | Isopropyl 1H-indole-3-propionate | ||
|---|---|---|---|---|
| CAS Number | 93941-02-7 | Molecular Weight | 231.29000 | |
| Density | 1.13g/cm3 | Boiling Point | 373.8ºC at 760 mmHg | |
| Molecular Formula | C14H17NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.9ºC | |
| Name | propan-2-yl 3-(1H-indol-3-yl)propanoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.13g/cm3 |
|---|---|
| Boiling Point | 373.8ºC at 760 mmHg |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29000 |
| Flash Point | 179.9ºC |
| Exact Mass | 231.12600 |
| PSA | 42.09000 |
| LogP | 3.05210 |
| Index of Refraction | 1.582 |
| InChIKey | ALEBZUNFHDQURI-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)CCc1c[nH]c2ccccc12 |
|
~%
Isopropyl 1H-in... CAS#:93941-02-7 |
| Literature: Mamidi, Narsimha; Manna, Debasis Journal of Organic Chemistry, 2013 , vol. 78, # 6 p. 2386 - 2396 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 1H-Indole-3-propanoic acid 1-methylethyl ester |
| isopropyl 1H-indole-3-propionate |
| Einecs 300-501-7 |
| isopropyl 3-(1H-indol-3-yl)propanoate |