1-Isopropyl-3-(4-fluorophenyl)-indole structure
|
Common Name | 1-Isopropyl-3-(4-fluorophenyl)-indole | ||
|---|---|---|---|---|
| CAS Number | 93957-49-4 | Molecular Weight | 253.314 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 389.6±25.0 °C at 760 mmHg | |
| Molecular Formula | C17H16FN | Melting Point | 96-97°C | |
| MSDS | N/A | Flash Point | 189.4±23.2 °C | |
| Name | 3-(4-Fluorophenyl)-1-isopropyl-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.6±25.0 °C at 760 mmHg |
| Melting Point | 96-97°C |
| Molecular Formula | C17H16FN |
| Molecular Weight | 253.314 |
| Flash Point | 189.4±23.2 °C |
| Exact Mass | 253.126678 |
| PSA | 4.93000 |
| LogP | 5.11 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.573 |
| InChIKey | ZDZJOIIBECYKAJ-UHFFFAOYSA-N |
| SMILES | CC(C)n1cc(-c2ccc(F)cc2)c2ccccc21 |
| Storage condition | Room temperature. |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36-S61 |
|
~81%
1-Isopropyl-3-(... CAS#:93957-49-4 |
| Literature: Walkup, R. E.; Linder, J. Tetrahedron Letters, 1985 , vol. 26, # 18 p. 2155 - 2158 |
|
~87%
1-Isopropyl-3-(... CAS#:93957-49-4 |
| Literature: Kim, Aejin; Kim, In Su Bulletin of the Korean Chemical Society, 2011 , vol. 32, # 10 p. 3748 - 3751 |
|
~44%
1-Isopropyl-3-(... CAS#:93957-49-4 |
| Literature: Kim, Aejin; Kim, In Su Bulletin of the Korean Chemical Society, 2011 , vol. 32, # 10 p. 3748 - 3751 |
|
~%
1-Isopropyl-3-(... CAS#:93957-49-4 |
| Literature: Tetrahedron Letters, , vol. 26, # 18 p. 2155 - 2158 |
|
~%
1-Isopropyl-3-(... CAS#:93957-49-4 |
| Literature: Tetrahedron Letters, , vol. 26, # 18 p. 2155 - 2158 |
|
~%
1-Isopropyl-3-(... CAS#:93957-49-4 |
| Literature: Bulletin of the Korean Chemical Society, , vol. 32, # 10 p. 3748 - 3751 |
|
~%
1-Isopropyl-3-(... CAS#:93957-49-4 |
| Literature: Bulletin of the Korean Chemical Society, , vol. 32, # 10 p. 3748 - 3751 |
| Precursor 8 | |
|---|---|
| DownStream 4 | |
| 3-(4-fluorophenyl)-1-propan-2-ylindole |
| 1-Isopropyl-3-(4-fluorophenyl)-indole |
| MFCD01075733 |
| 3-(4-Fluorophenyl)-1-(propan-2-yl)-1H-indole |
| T56 BNJ BY1&1 DR DF |
| 1H-Indole, 3-(4-fluorophenyl)-1-(1-methylethyl)- |
| 3-(4-Fluorophenyl)-1-isopropyl-1H-indole |
| EINECS 418-790-4 |
| 3-(4-FLUOROPHENYL)-1-(1-METHYLETHYL)-1H-INDOLE |
| 1-Isopropyl-3-(4-fluorophenyl)indole |