Dioctyl phthalate-d4 structure
|
Common Name | Dioctyl phthalate-d4 | ||
|---|---|---|---|---|
| CAS Number | 93952-13-7 | Molecular Weight | 394.58100 | |
| Density | 0.991 g/mL at 25ºC | Boiling Point | 384ºC(lit.) | |
| Molecular Formula | C24H34D4O4 | Melting Point | -50ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 405 °F | |
| Name | Di-n-octyl Phthalate-d4 |
|---|---|
| Synonym | More Synonyms |
| Description |
|---|
| Density | 0.991 g/mL at 25ºC |
|---|---|
| Boiling Point | 384ºC(lit.) |
| Melting Point | -50ºC(lit.) |
| Molecular Formula | C24H34D4O4 |
| Molecular Weight | 394.58100 |
| Flash Point | 405 °F |
| Exact Mass | 394.30200 |
| PSA | 52.60000 |
| LogP | 6.72120 |
| Index of Refraction | n20/D 1.486(lit.) |
| InChIKey | MQIUGAXCHLFZKX-AMEAAFLOSA-N |
| SMILES | CCCCCCCCOC(=O)c1ccccc1C(=O)OCCCCCCCC |
| Storage condition | Refrigerator |
| RIDADR | UN 3082 9 / PGIII |
|---|---|
| WGK Germany | 2 |
|
Occurrence and risk assessment of selected phthalates in drinking water from waterworks in China.
Environ. Sci. Pollut. Res. Int. 22 , 10690-8, (2015) The first nationwide survey of six phthalates (diethyl phthalate (DEP); dimethyl phthalate (DMP); di-n-butyl phthalate (DBP); butyl benzyl phthalate (BBP); bis(2-ethylhexyl) phthalate (DEHP); din-octy... |
| MFCD00144150 |
| dioctyl 3,4,5,6-tetradeuteriobenzene-1,2-dicarboxylate |