6-chloro-4-(2-chlorophenyl)quinazoline-2-carbaldehyde structure
|
Common Name | 6-chloro-4-(2-chlorophenyl)quinazoline-2-carbaldehyde | ||
|---|---|---|---|---|
| CAS Number | 93955-15-8 | Molecular Weight | 303.14300 | |
| Density | 1.437g/cm3 | Boiling Point | 482ºC at 760mmHg | |
| Molecular Formula | C15H8Cl2N2O | Melting Point | 159ºC | |
| MSDS | N/A | Flash Point | 245.3ºC | |
| Symbol |
GHS06 |
Signal Word | Danger | |
| Name | 6-chloro-4-(2-chlorophenyl)quinazoline-2-carbaldehyde |
|---|
| Density | 1.437g/cm3 |
|---|---|
| Boiling Point | 482ºC at 760mmHg |
| Melting Point | 159ºC |
| Molecular Formula | C15H8Cl2N2O |
| Molecular Weight | 303.14300 |
| Flash Point | 245.3ºC |
| Exact Mass | 302.00100 |
| PSA | 42.85000 |
| LogP | 4.41610 |
| Index of Refraction | 1.699 |
| InChIKey | VUUITUUENPOMIU-UHFFFAOYSA-N |
| SMILES | O=Cc1nc(-c2ccccc2Cl)c2cc(Cl)ccc2n1 |
| Symbol |
GHS06 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H301-H319-H413 |
| Precautionary Statements | P301 + P310-P305 + P351 + P338 |
| RIDADR | UN 2811 6.1 / PGIII |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |