4-chlorophenylbutyl 4-methylbenzenesulphonate structure
|
Common Name | 4-chlorophenylbutyl 4-methylbenzenesulphonate | ||
|---|---|---|---|---|
| CAS Number | 93982-99-1 | Molecular Weight | 338.84900 | |
| Density | 1.224g/cm3 | Boiling Point | 465ºC at 760mmHg | |
| Molecular Formula | C17H19ClO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235ºC | |
| Name | 4-(4-chlorophenyl)butyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.224g/cm3 |
|---|---|
| Boiling Point | 465ºC at 760mmHg |
| Molecular Formula | C17H19ClO3S |
| Molecular Weight | 338.84900 |
| Flash Point | 235ºC |
| Exact Mass | 338.07400 |
| PSA | 51.75000 |
| LogP | 5.45740 |
| Index of Refraction | 1.563 |
| InChIKey | GMBWFZODOYMUJF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCCCc2ccc(Cl)cc2)cc1 |
| HS Code | 2906299090 |
|---|
|
~72%
4-chlorophenylb... CAS#:93982-99-1 |
| Literature: Yu; Kim; Park; Yang; Herdering; Knoechel Journal of Labelled Compounds and Radiopharmaceuticals, 2003 , vol. 46, # 12 p. 1151 - 1160 |
|
~%
4-chlorophenylb... CAS#:93982-99-1 |
| Literature: Yu; Kim; Park; Yang; Herdering; Knoechel Journal of Labelled Compounds and Radiopharmaceuticals, 2003 , vol. 46, # 12 p. 1151 - 1160 |
| HS Code | 2906299090 |
|---|---|
| Summary | 2906299090 other aromatic alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| EINECS 301-286-2 |
| 4-Chlorophenylbutyl 4-methylbenzenesulphonate |
| 4-CHLOROPHENYLBUTYL 4-METHYLBENZENESULFONATE |
| 4-(4-chlorophenyl)butyl tosylate |