propyl 2-hydroxy-2,2-diphenylacetate structure
|
Common Name | propyl 2-hydroxy-2,2-diphenylacetate | ||
|---|---|---|---|---|
| CAS Number | 94006-12-9 | Molecular Weight | 270.32300 | |
| Density | 1.142g/cm3 | Boiling Point | 351.4ºC at 760mmHg | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 120.7ºC | |
| Name | propyl 2-hydroxy-2,2-diphenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 351.4ºC at 760mmHg |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32300 |
| Flash Point | 120.7ºC |
| Exact Mass | 270.12600 |
| PSA | 46.53000 |
| LogP | 2.87570 |
| Index of Refraction | 1.563 |
| InChIKey | IKFSGYFNHOQVPF-UHFFFAOYSA-N |
| SMILES | CCCOC(=O)C(O)(c1ccccc1)c1ccccc1 |
| HS Code | 2918199090 |
|---|
|
~%
propyl 2-hydrox... CAS#:94006-12-9 |
| Literature: Acree Chemische Berichte, 1904 , vol. 37, p. 2762 American Chemical Journal, 1905 , vol. 33, p. 189 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| benzilic acid propyl ester |
| EINECS 301-348-9 |
| Benzilsaeure-propylester |
| Propyl diphenylglycolate |
| PROPYL 2-HYDROXY-2,2-DIPHENYL-ACETATE |