Benzilic acid structure
|
Common Name | Benzilic acid | ||
|---|---|---|---|---|
| CAS Number | 76-93-7 | Molecular Weight | 228.243 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 409.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C14H12O3 | Melting Point | 149-151 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 215.3±23.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | benzilic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 409.0±40.0 °C at 760 mmHg |
| Melting Point | 149-151 °C(lit.) |
| Molecular Formula | C14H12O3 |
| Molecular Weight | 228.243 |
| Flash Point | 215.3±23.8 °C |
| Exact Mass | 228.078644 |
| PSA | 57.53000 |
| LogP | 3.03 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | UKXSKSHDVLQNKG-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)(c1ccccc1)c1ccccc1 |
| Stability | Stable. Incompatible with strong oxidizing agents. Combustible. |
| Water Solubility | 1.41 g/L (25 ºC) |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Precautionary Statements | P301 + P312 + P330 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S36-S36/37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | DD2064000 |
| HS Code | 29181980 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 29181980 |
|---|
|
Molecular modifications on carboxylic acid derivatives as potent histone deacetylase inhibitors: Activity and docking studies.
Bioorg. Med. Chem. 17 , 5219-28, (2009) In the light of known HDAC inhibitors, 33 carboxylic acid derivatives were tested to understand the structural requirements for HDAC inhibition activity. Several modifications were applied to develop ... |
|
Name: Experimentally measured binding affinity data (Ki) for protein-ligand complexes deriv...
Source: Shanghai Institute of Organic Chemistry
Target: N/A
External Id: PDBbind-Ki for protein-ligand complexes
|
|
Name: qHTS for Inhibitors of Polymerase Kappa
Source: NCGC
Target: DNA polymerase kappa [Homo sapiens]
External Id: PolK100
|
|
Name: Inhibition of HDAC in human Hela cells nuclear extracts assessed as residual activity...
Source: ChEMBL
Target: Histone deacetylase 5
External Id: CHEMBL1040171
|
|
Name: Cell-based high throughput primary assay to identify activators of GPR151
Source: The Scripps Research Institute Molecular Screening Center
Target: RecName: Full=G-protein coupled receptor 151; AltName: Full=G-protein coupled receptor PGR7; AltName: Full=GPCR-2037; AltName: Full=Galanin receptor 4; AltName: Full=Galanin-receptor-like protein; Short=GalRL
External Id: GPR151_PHUNTER_AG_LUMI_1536_1X%ACT
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify activators of...
Source: The Scripps Research Institute Molecular Screening Center
Target: N/A
External Id: FBW7_ACT_ALPHA_1536_1X%ACT PRUN
|
|
Name: AlphaScreen-based biochemical high throughput primary assay to identify inhibitors of...
Source: The Scripps Research Institute Molecular Screening Center
External Id: MITF_INH_Alpha_1536_1X%INH PRUN
|
|
Name: qHTS for Inhibitors of binding or entry into cells for Marburg Virus
Source: NCGC
Target: gene 4 small orf - Marburg virus
External Id: VSVM-OFFLINE
|
|
Name: qHTS for Inhibitors of binding or entry into cells for Lassa Virus
Source: NCGC
Target: N/A
External Id: VSVL-OFFLINE
|
| 2-hydroxy-2,2-diphenylacetic acid |
| Benzylic acid |
| EINECS 200-993-2 |
| Benzilic acid |
| 2-hydroxy-2,2-diphenylethanoic acid |
| Diphenylhydroxyacetic acid |
| 2,2-diphenyl-2-hydroxyethanoic acid |
| Diphenylglycolic acid |
| 4-10-00-01256 (Beilstein Handbook Reference) |
| 2,2-Diphenyl-2-hydroxyacetic acid |
| 2,2-Diphenyl-2-hydroxy acetate |
| Hydroxy(diphenyl)acetic acid |
| Glycolic acid,diphenyl |
| MFCD00004447 |
| a-Hydroxy-a-phenylbenzeneacetic Acid |
| α-Hydroxy-2,2-diphenylacetic acid |