chloro-[dimethyl(phenyl)silyl]-dimethylsilane structure
|
Common Name | chloro-[dimethyl(phenyl)silyl]-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 941-15-1 | Molecular Weight | 228.86600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17ClSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | chloro-[dimethyl(phenyl)silyl]-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H17ClSi2 |
|---|---|
| Molecular Weight | 228.86600 |
| Exact Mass | 228.05600 |
| LogP | 3.12430 |
| InChIKey | ZIVNGTYZHCFQGY-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Cl)[Si](C)(C)c1ccccc1 |
|
~%
chloro-[dimethy... CAS#:941-15-1 |
| Literature: Murakami, Masahiro; Suginome, Michinori; Fujimoto, Kenzo; Nakamura, Hiroshi; Andersson, Pher G.; Ito, Yoshihiko Journal of the American Chemical Society, 1993 , vol. 115, # 15 p. 6487 - 6498 |
|
~74%
chloro-[dimethy... CAS#:941-15-1 |
| Literature: Ando, Wataru; Sugiyama, Mitsuru; Suzuki, Tomohisa; Kato, Chikako; Arakawa, Yusuke; Kabe, Yoshio Journal of Organometallic Chemistry, 1995 , vol. 499, # 1.2 p. 99 - 112 |
| 1-chloro-1,1,2,2-tetramethyl-2-phenyldisilane |
| 1-chloro-2-phenyltetramethyldisilane |
| 1-chloro-2-phenyl-1,1,2,2,-tetramethyldisilane |
| Me2PhSiSiMe2Cl |
| 1-Chlor-2-phenyl-tetramethyl-disilan |
| Disilane,1-chloro-1,1,2,2-tetramethyl-2-phenyl |
| 1-chlorotetramethyl-2-phenyldisilane |