bis[chloro(dimethyl)silyl]-dimethylsilane structure
|
Common Name | bis[chloro(dimethyl)silyl]-dimethylsilane | ||
|---|---|---|---|---|
| CAS Number | 812-36-2 | Molecular Weight | 245.37000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C6H18Cl2Si3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: bis[chloro(dimethyl)silyl]-dimethylsilane (di(dimethylchlorosilyl)dimethylsilane) with CAS number 812-36-2, has a molecular formula of C6H18Cl2Si3 and a molecular weight of 245.37. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | bis[chloro(dimethyl)silyl]-dimethylsilane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C6H18Cl2Si3 |
|---|---|
| Molecular Weight | 245.37000 |
| Exact Mass | 244.00900 |
| LogP | 3.73940 |
| InChIKey | VXZHPKCBWCBOAU-UHFFFAOYSA-N |
| SMILES | C[Si](C)(Cl)[Si](C)(C)[Si](C)(C)Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 6 | |
|---|---|
| DownStream 6 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ClMe2SiSiMe2Cl |
| 1,1,2,2,3,3-hexamethyl-1,3-dichlorotrisilane |
| Trisilane,1,3-dichloro-1,1,2,2,3,3-hexamethyl |
| 1,3-Dichloro-1,1,2,2,3,3-hexamethyltrisilane |
| 1,3-dichlorohexamethyltrisilane |
| ClMe2Si-SiMe2-SiMe2Cl |
| 1,3-Dichlorhexamethyltrisilan |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of bis[chloro(dimethyl)silyl]-dimethylsilane? |
| A: LogP of bis[chloro(dimethyl)silyl]-dimethylsilane is 3.73940. |
| Q: What are the downstream products of bis[chloro(dimethyl)silyl]-dimethylsilane? |
| A: Related downstream products(CAS) of bis[chloro(dimethyl)silyl]-dimethylsilane: 1145-98-8;10536-53-5;24720-55-6;116161-01-4;4774-85-0;5586-42-5. |
| Q: What is the English name of bis[chloro(dimethyl)silyl]-dimethylsilane? |
| A: The English name of bis[chloro(dimethyl)silyl]-dimethylsilane is bis[chloro(dimethyl)silyl]-dimethylsilane. |
| Q: What is the molecular weight of bis[chloro(dimethyl)silyl]-dimethylsilane? |
| A: Molecular weight of bis[chloro(dimethyl)silyl]-dimethylsilane is 245.37000. |
| Q: What are the upstream materials of bis[chloro(dimethyl)silyl]-dimethylsilane? |
| A: Related upstream materials(CAS) of bis[chloro(dimethyl)silyl]-dimethylsilane: 3704-44-7;754-38-1;10536-53-5;4098-30-0;4342-61-4;75-78-5. |
| Q: What is the CAS number of bis[chloro(dimethyl)silyl]-dimethylsilane? |
| A: CAS number of bis[chloro(dimethyl)silyl]-dimethylsilane is 812-36-2. |
| Q: What is the InChIKey of bis[chloro(dimethyl)silyl]-dimethylsilane? |
| A: InChIKey of bis[chloro(dimethyl)silyl]-dimethylsilane is VXZHPKCBWCBOAU-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of bis[chloro(dimethyl)silyl]-dimethylsilane? |
| A: SMILES notation of bis[chloro(dimethyl)silyl]-dimethylsilane is C[Si](C)(Cl)[Si](C)(C)[Si](C)(C)Cl. |
| Q: What English synonyms does bis[chloro(dimethyl)silyl]-dimethylsilane have? |
| A: English synonyms of bis[chloro(dimethyl)silyl]-dimethylsilane: ClMe2SiSiMe2Cl, 1,1,2,2,3,3-hexamethyl-1,3-dichlorotrisilane, Trisilane,1,3-dichloro-1,1,2,2,3,3-hexamethyl, 1,3-Dichloro-1,1,2,2,3,3-hexamethyltrisilane, 1,3-dichlorohexamethyltrisilane, ClMe2Si-SiMe2-SiMe2Cl, 1,3-Dichlorhexamethyltrisilan. |
| Q: What is the Chinese name of 812-36-2? |
| A: Chinese name of 812-36-2 is 812-36-2. |