2-[(2-bromo-3-methylbutanoyl)amino]-3-phenylpropanoic acid structure
|
Common Name | 2-[(2-bromo-3-methylbutanoyl)amino]-3-phenylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 94107-41-2 | Molecular Weight | 328.20200 | |
| Density | 1.389g/cm3 | Boiling Point | 496.6ºC at 760mmHg | |
| Molecular Formula | C14H18BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 254.2ºC | |
| Name | 2-[(2-bromo-3-methylbutanoyl)amino]-3-phenylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.389g/cm3 |
|---|---|
| Boiling Point | 496.6ºC at 760mmHg |
| Molecular Formula | C14H18BrNO3 |
| Molecular Weight | 328.20200 |
| Flash Point | 254.2ºC |
| Exact Mass | 327.04700 |
| PSA | 69.89000 |
| LogP | 3.05830 |
| Index of Refraction | 1.56 |
| InChIKey | RGIHFSFFOHEHAX-UHFFFAOYSA-N |
| SMILES | CC(C)C(Br)C(=O)NC(Cc1ccccc1)C(=O)O |
| HS Code | 2924299090 |
|---|
|
~%
2-[(2-bromo-3-m... CAS#:94107-41-2 |
| Literature: Abderhalden; Herrmann Fermentforschung, vol. 10, p. 154 Chem. Zentralbl., 1929 , vol. 100, # I p. 2313 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| N-(2-bromo-3-methylbutyryl)-3-phenyl-DL-alanine |