Bromo(tert-butyl)methoxy(phenyl)silane structure
|
Common Name | Bromo(tert-butyl)methoxy(phenyl)silane | ||
|---|---|---|---|---|
| CAS Number | 94124-39-7 | Molecular Weight | 273.242 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 288.3±0.0 °C at 760 mmHg | |
| Molecular Formula | C11H17BrOSi | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 106.1±0.0 °C | |
| Name | bromo-tert-butyl-methoxy-phenylsilane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 288.3±0.0 °C at 760 mmHg |
| Molecular Formula | C11H17BrOSi |
| Molecular Weight | 273.242 |
| Flash Point | 106.1±0.0 °C |
| Exact Mass | 272.023193 |
| PSA | 9.23000 |
| LogP | 5.77 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.509 |
| InChIKey | VFFLZSQFWJXUJJ-UHFFFAOYSA-N |
| SMILES | CO[Si](Br)(c1ccccc1)C(C)(C)C |
| Storage condition | Refrigerator |
| Hazard Codes | C: Corrosive; |
|---|---|
| Risk Phrases | 34 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 3265 8/PG 2 |
| WGK Germany | 3 |
| Packaging Group | III |
| HS Code | 2931900090 |
|
~65%
Bromo(tert-buty... CAS#:94124-39-7 |
| Literature: Guindon, Yvan; Fortin, Rejean; Yoakim, Christiane; Gillard, John W. Tetrahedron Letters, 1984 , vol. 25, # 42 p. 4717 - 4720 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2931900090 |
|---|---|
| Summary | 2931900090. other organo-inorganic compounds. VAT:17.0%. Tax rebate rate:13.0%. Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward). MFN tariff:6.5%. General tariff:30.0% |
| Benzene, [bromo(1,1-dimethylethyl)methoxysilyl]- |
| tert-Butylmethoxyphenylsilyl Bromide |
| Bromo(tert-butyl)methoxy(phenyl)silane |
| Bromo(methoxy)(2-methyl-2-propanyl)(phenyl)silane |
| TBMPSiBr |
| tert-butylphenylmethoxysilyl bromide |
| MFCD00043308 |