4,4'-[2,5-Biphenyldiylbis(oxy)]dianiline structure
|
Common Name | 4,4'-[2,5-Biphenyldiylbis(oxy)]dianiline | ||
|---|---|---|---|---|
| CAS Number | 94148-67-1 | Molecular Weight | 368.428 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 567.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.4±23.8 °C | |
| Name | 4-[4-(4-aminophenoxy)-3-phenylphenoxy]aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 567.6±50.0 °C at 760 mmHg |
| Molecular Formula | C24H20N2O2 |
| Molecular Weight | 368.428 |
| Flash Point | 318.4±23.8 °C |
| Exact Mass | 368.152466 |
| PSA | 70.50000 |
| LogP | 4.34 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.670 |
| InChIKey | JWRLKLYWXKMAFL-UHFFFAOYSA-N |
| SMILES | Nc1ccc(Oc2ccc(Oc3ccc(N)cc3)c(-c3ccccc3)c2)cc1 |
| HS Code | 2922299090 |
|---|
| HS Code | 2922299090 |
|---|---|
| Summary | 2922299090. other amino-naphthols and other amino-phenols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenamine, 4,4'-((1,1'-biphenyl)-2,5-diylbis(oxy))bis- |
| 4,4'-[2,5-Biphenyldiylbis(oxy)]dianiline |
| papb |
| 4,4'-[biphenyl-2,5-diylbis(oxy)]dianiline |
| Benzenamine, 4,4'-[[1,1'-biphenyl]-2,5-diylbis(oxy)]bis- |