2,2'-[(4-Amino-3-nitrophenyl)imino]bisethanol hydrochloride
Modify Date: 2024-01-08 12:40:54
![2,2'-[(4-Amino-3-nitrophenyl)imino]bisethanol hydrochloride Structure](https://image.chemsrc.com/caspic/190/94158-13-1.png)
2,2'-[(4-Amino-3-nitrophenyl)imino]bisethanol hydrochloride structure
|
Common Name | 2,2'-[(4-Amino-3-nitrophenyl)imino]bisethanol hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 94158-13-1 | Molecular Weight | 277.70500 | |
| Density | N/A | Boiling Point | 515.9ºC at 760 mmHg | |
| Molecular Formula | C10H16ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.8ºC | |
| Name | 2-[4-amino-N-(2-hydroxyethyl)-3-nitroanilino]ethanol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 515.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C10H16ClN3O4 |
| Molecular Weight | 277.70500 |
| Flash Point | 265.8ºC |
| Exact Mass | 277.08300 |
| PSA | 115.54000 |
| LogP | 1.87440 |
| InChIKey | ASAQRGCLIPUSEK-UHFFFAOYSA-N |
| SMILES | Cl.Nc1ccc(N(CCO)CCO)cc1[N+](=O)[O-] |
| Risk Phrases | R22 |
|---|---|
| Safety Phrases | 26-36/37/39 |
| HS Code | 2922199090 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| HC Red no. 13 |
| 1-amino-2-nitro-4-bis-(2'-hydroxyethyl)aminobenzene hydrochloride |
| 2,2'-((4-Amino-3-nitrophenyl)azanediyl)diethanol hydrochloride |
| 2,2'-[(4-Amino-3-nitrophenyl)imino]bisethanol hydrochloride |
| MFCD00239472 |
| EINECS 303-083-4 |