2-aminopyridine
Modify Date: 2026-07-12 16:41:27
2-aminopyridine structure
|
Common Name | 2-aminopyridine | ||
|---|---|---|---|---|
| CAS Number | 94166-58-2 | Molecular Weight | 183.16500 | |
| Density | 1.327g/cm3 | Boiling Point | 204-210ºC(lit.) | |
| Molecular Formula | C7H9N3O3 | Melting Point | 54-58ºC(lit.) | |
| MSDS | N/A | Flash Point | 204-210ºC(lit.) | |
| Name | 6-methoxy-N-methyl-3-nitropyridin-2-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.327g/cm3 |
|---|---|
| Boiling Point | 204-210ºC(lit.) |
| Melting Point | 54-58ºC(lit.) |
| Molecular Formula | C7H9N3O3 |
| Molecular Weight | 183.16500 |
| Flash Point | 204-210ºC(lit.) |
| Exact Mass | 183.06400 |
| PSA | 79.97000 |
| LogP | 1.63630 |
| Index of Refraction | 1.599 |
| InChIKey | RSFNGZVULJTWHW-UHFFFAOYSA-N |
| SMILES | CNc1nc(OC)ccc1[N+](=O)[O-] |
| Hazard Codes | T |
|---|---|
| Risk Phrases | 21-25-36/37/38 |
| Safety Phrases | 26-36/37/39-45 |
| RIDADR | UN 2671 6.1/PG 2 |
| WGK Germany | 3 |
| RTECS | US1575000 |
| HS Code | 2933399090 |
|
~%
2-aminopyridine CAS#:94166-58-2 |
| Literature: Sankyo Company, Limited Patent: US5624935 A1, 1997 ; |
|
~91%
2-aminopyridine CAS#:94166-58-2 |
| Literature: Oguchi; Wada; Honma; Tanaka; Kaneko; Sakakibara; Ohsumi; Serizawa; Fujiwara; Horikoshi; Fujita Journal of Medicinal Chemistry, 2000 , vol. 43, # 16 p. 3052 - 3066 |
|
~%
2-aminopyridine CAS#:94166-58-2 |
| Literature: Oguchi; Wada; Honma; Tanaka; Kaneko; Sakakibara; Ohsumi; Serizawa; Fujiwara; Horikoshi; Fujita Journal of Medicinal Chemistry, 2000 , vol. 43, # 16 p. 3052 - 3066 |
CAS#:90817-34-8| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 303-354-7 |
| OR3141 |
| EINECS 207-988-4 |
| 2-Methylamino-3-nitro-6-methoxypyridine |
| 6-methoxy-2-methylamino-3-nitropyridine |
| MFCD00006312 |