Perfluorophenyl 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzoate structure
|
Common Name | Perfluorophenyl 4-(3,5-dimethyl-1H-pyrazol-1-yl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 941717-00-6 | Molecular Weight | 382.28400 | |
| Density | 1.42g/cm3 | Boiling Point | 496.5ºC at 760 mmHg | |
| Molecular Formula | C18H11F5N2O2 | Melting Point | 85.5-86ºC | |
| MSDS | N/A | Flash Point | 254.1ºC | |
| Name | (2,3,4,5,6-pentafluorophenyl) 4-(3,5-dimethylpyrazol-1-yl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 496.5ºC at 760 mmHg |
| Melting Point | 85.5-86ºC |
| Molecular Formula | C18H11F5N2O2 |
| Molecular Weight | 382.28400 |
| Flash Point | 254.1ºC |
| Exact Mass | 382.07400 |
| PSA | 44.12000 |
| LogP | 4.40380 |
| Index of Refraction | 1.553 |
| InChIKey | GQQALUKKLLEHOR-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)n(-c2ccc(C(=O)Oc3c(F)c(F)c(F)c(F)c3F)cc2)n1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933199090 |
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD09879978 |