diethyl 4-butyl-1,4-dihydro-2,6-dimethylpyridine-3,5-dicarboxylate structure
|
Common Name | diethyl 4-butyl-1,4-dihydro-2,6-dimethylpyridine-3,5-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 94266-06-5 | Molecular Weight | 309.40100 | |
| Density | 1.031g/cm3 | Boiling Point | 403.2ºC at 760mmHg | |
| Molecular Formula | C17H27NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.7ºC | |
| Name | diethyl 4-butyl-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.031g/cm3 |
|---|---|
| Boiling Point | 403.2ºC at 760mmHg |
| Molecular Formula | C17H27NO4 |
| Molecular Weight | 309.40100 |
| Flash Point | 197.7ºC |
| Exact Mass | 309.19400 |
| PSA | 64.63000 |
| LogP | 3.39900 |
| Index of Refraction | 1.477 |
| InChIKey | ZGAVXRFBMMMOJP-UHFFFAOYSA-N |
| SMILES | CCCCC1C(C(=O)OCC)=C(C)NC(C)=C1C(=O)OCC |
| HS Code | 2933399090 |
|---|
|
~74%
diethyl 4-butyl... CAS#:94266-06-5 |
| Literature: Amgoth, Srinivas Nayak; Porika, Mahendar; Abbagani, Sadanandam; Garlapati, Achaiah; Vanga, Malla Reddy Medicinal Chemistry Research, 2013 , vol. 22, # 1 p. 147 - 155 |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-n-butyl-3,5-bis(carboethoxy)-1,4-dihydro-2,6-dimethylpyridine |
| 4-butyl-2,6-dimethyl-1,4-dihydro-pyridine-3,5-dicarboxylic acid diethyl ester |
| EINECS 304-412-4 |
| 4-Butyl-2,6-dimethyl-1,4-dihydro-pyridin-3,5-dicarbonsaeure-diaethylester |
| Diethyl 4-butyl-1,4-dihydro-2,6-dimethylpyridine-3,5-dicarboxylate |
| 4-butyl-1,4-dihydro-2,6-dimethyl-3,5-pyridinedicarboxylate |