Benzene,1-methyl-4-(1-methylethyl)-2-nitro- structure
|
Common Name | Benzene,1-methyl-4-(1-methylethyl)-2-nitro- | ||
|---|---|---|---|---|
| CAS Number | 943-15-7 | Molecular Weight | 179.21600 | |
| Density | 1.069g/cm3 | Boiling Point | 241.7ºC at 760mmHg | |
| Molecular Formula | C10H13NO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 90.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-Isopropyl-1-methyl-2-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.069g/cm3 |
|---|---|
| Boiling Point | 241.7ºC at 760mmHg |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.21600 |
| Flash Point | 90.2ºC |
| Exact Mass | 179.09500 |
| PSA | 45.82000 |
| LogP | 3.54980 |
| Index of Refraction | n20/D 1.528(lit.) |
| InChIKey | DRKFWQDBPGTSOO-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(C)C)cc1[N+](=O)[O-] |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302 |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | 36/37/39-26 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2904209090 |
| Precursor 7 | |
|---|---|
| DownStream 5 | |
| HS Code | 2904209090 |
|---|---|
| Summary | 2904209090 derivatives containing only nitro or only nitroso groups。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
Preparation of Aldehydes from Alkenes by the Addition of Carbon Monoxide and Hydrogen with Cobalt Carbonyls as Intermediates. Adkins H and Krsek G.
J. Am. Chem. Soc. 70(1) , 383-86, (1948)
|
|
|
Response characteristics of conductive polymer composite substrate all-solid-state poly (vinyl chloride) matrix membrane ion-selective electrodes in aerated and nitrogen-saturated solutions. Alegret S and Florido A.
Analyst 116(5) , 473-76, (1991)
|
|
|
Reduction of 2-nitro-p-cymene. Holmes J, et al.
J. Chem. Eng. Data 27(4) , 470-72, (1982)
|
| 1-methyl-2-nitro-4-propan-2-ylbenzene |
| EINECS 213-397-2 |
| MFCD00007176 |