potassium pentamethylcyclopentadienide
potassium pentamethylcyclopentadienide structure
|
Common Name | potassium pentamethylcyclopentadienide | ||
|---|---|---|---|---|
| CAS Number | 94348-92-2 | Molecular Weight | 174.32400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H15K | Melting Point | >230ºC(lit.) | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | potassium pentamethylcyclopentadienide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Melting Point | >230ºC(lit.) |
|---|---|
| Molecular Formula | C10H15K |
| Molecular Weight | 174.32400 |
| Exact Mass | 174.08100 |
| LogP | 3.40070 |
| InChIKey | CNTPKXIECBGFKF-UHFFFAOYSA-N |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.[K+] |
This table provides MSDS information including hazard classification, first‑aid, fire‑fighting, spill handling, operation and storage instructions.
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | F: Flammable; |
|---|---|
| Risk Phrases | 34-17-15 |
| Safety Phrases | 45-43-36/37/39-26-24-16-6 |
| RIDADR | UN 3393 4.2/PG 1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~97%
potassium penta... CAS#:94348-92-2 |
| Literature: Rabe, Gerd; Roesky, Herbert W.; Stalke, Dietmar; Pauer, Frank; Sheldrick, George M. Journal of Organometallic Chemistry, 1991 , vol. 403, # 1.2 p. 11 - 19 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 1 | |
|---|---|
| DownStream 1 | |
CAS#:67506-88-1This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| kpaba |
| 4-Aminobenzoic acid potassium salt |
| Potassium 1,2,3,4,5-pentamethyl-2,4-cyclopentadienide |
| potassium p-aminobenzoate |
| potassium salt of para amino benzoic acid |
| para-aminobenzoic acid potassium salt |
| MFCD00799575 |
| potassium pentamethylcyclopentadienyl |
| p-Aminobenzoic acid potassium salt |
| Potassium 4-aminobenzoate |
| pentamethylcyclopentadienyl potassium |
| Pentamethylcyclopentadienyl-Kalium |
| Aminobenzoate potassium |
| potassium pentamethylcyclopentadiene |
| pentamethylcyclopentadienyl potasssium |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of potassium pentamethylcyclopentadienide? |
| A: Molecular formula of potassium pentamethylcyclopentadienide is C10H15K. |
| Q: What is the CAS number of potassium pentamethylcyclopentadienide? |
| A: CAS number of potassium pentamethylcyclopentadienide is 94348-92-2. |
| Q: What is the SMILES notation of potassium pentamethylcyclopentadienide? |
| A: SMILES notation of potassium pentamethylcyclopentadienide is Cc1c(C)c(C)[c-](C)c1C.[K+]. |
| Q: What is the LogP of potassium pentamethylcyclopentadienide? |
| A: LogP of potassium pentamethylcyclopentadienide is 3.40070. |
| Q: What is the InChIKey of potassium pentamethylcyclopentadienide? |
| A: InChIKey of potassium pentamethylcyclopentadienide is CNTPKXIECBGFKF-UHFFFAOYSA-N. |
| Q: What are the upstream materials of potassium pentamethylcyclopentadienide? |
| A: Related upstream materials(CAS) of potassium pentamethylcyclopentadienide: 4045-44-7. |
| Q: What is the molecular weight of potassium pentamethylcyclopentadienide? |
| A: Molecular weight of potassium pentamethylcyclopentadienide is 174.32400. |
| Q: What is the melting point of potassium pentamethylcyclopentadienide? |
| A: Melting point of potassium pentamethylcyclopentadienide is >230ºC(lit.). |
| Q: What are the downstream products of potassium pentamethylcyclopentadienide? |
| A: Related downstream products(CAS) of potassium pentamethylcyclopentadienide: 67506-88-1. |
| Q: What is the safety information for potassium pentamethylcyclopentadienide? |
| A: Safety information for potassium pentamethylcyclopentadienide: 45-43-36/37/39-26-24-16-6. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |