tert-butyl 2-amino-3-(4-methoxy-3,4-dioxobutanoyl)benzoate structure
|
Common Name | tert-butyl 2-amino-3-(4-methoxy-3,4-dioxobutanoyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 943641-43-8 | Molecular Weight | 321.32500 | |
| Density | 1.235g/cm3 | Boiling Point | 429.1ºC at 760 mmHg | |
| Molecular Formula | C16H19NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.3ºC | |
| Name | tert-butyl 2-amino-3-(4-methoxy-3,4-dioxobutanoyl)benzoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 429.1ºC at 760 mmHg |
| Molecular Formula | C16H19NO6 |
| Molecular Weight | 321.32500 |
| Flash Point | 213.3ºC |
| Exact Mass | 321.12100 |
| PSA | 98.77000 |
| LogP | 2.42150 |
| Index of Refraction | 1.542 |
| InChIKey | BEDQPUSLSIQSOQ-UHFFFAOYSA-N |
| SMILES | COC(=O)C(=O)CC(=O)c1cccc(C(=O)OC(C)(C)C)c1N |
| Hazard Codes | Xi,F |
|---|---|
| HS Code | 2924299090 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(3-Boc-Amino-phenyl)-2,4-dioxo-butyric acid methyl ester |