Methylnissolin-3-O-glucoside structure
|
Common Name | Methylnissolin-3-O-glucoside | ||
|---|---|---|---|---|
| CAS Number | 94367-42-7 | Molecular Weight | 462.44700 | |
| Density | 1.456±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 646.3±55.0 °C (760 mmHg) | |
| Molecular Formula | C23H26O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Methylnissolin-3-O-glucosideMethylnissolin-3-O-glucoside (Methylnissolin-3-O-β-D-glucoside) is a flavonoid from the roots of Astragalus membranaceus with anti-inflammatory effects[1]. |
| Name | β-D-Glucopyranoside, (6aR,11aR)-6a,11a-dihydro-9,10-dimethoxy-6H-benzofuro[3,2-c][1]benzopyran-3-yl |
|---|---|
| Synonym | More Synonyms |
| Description | Methylnissolin-3-O-glucoside (Methylnissolin-3-O-β-D-glucoside) is a flavonoid from the roots of Astragalus membranaceus with anti-inflammatory effects[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.456±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 646.3±55.0 °C (760 mmHg) |
| Molecular Formula | C23H26O10 |
| Molecular Weight | 462.44700 |
| Exact Mass | 462.15300 |
| PSA | 136.30000 |
| LogP | 0.49220 |
| InChIKey | PCIXSTFFMHVOMF-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1OC)OC1c3ccc(OC4OC(CO)C(O)C(O)C4O)cc3OCC21 |
| Water Solubility | Practically insoluble (0.083 g/L) (25 ºC) |
| 9,10-Dimethoxy-pterocarpan-3-O-β-D-glucopyranoside |
| (6aR,11aR)-9,10-Dimethoxypterocarpan 3-O-β-D-glucoside |
| 6H-Benzofuro[3,2-c][1]benzopyran, β-D-glucopyranoside deriv. |
| (6aR,11aR)-3-Hydroxy-9,10-dimethoxypterocarpan 3-O-β-D-glycoside |
| β-D-Glucopyranoside, 6a,11a-dihydro-9,10-dimethoxy-6H-benzofuro[3,2-c][1]benzopyran-3-yl, (6aR-cis)- |
| 9-O-Methylnissolin 3-O-glucoside |