2-naphthalen-2-yl-3-(2-nitroethenyl)-1H-indole structure
|
Common Name | 2-naphthalen-2-yl-3-(2-nitroethenyl)-1H-indole | ||
|---|---|---|---|---|
| CAS Number | 94464-02-5 | Molecular Weight | 314.33700 | |
| Density | 1.317g/cm3 | Boiling Point | 583.2ºC at 760 mmHg | |
| Molecular Formula | C20H14N2O2 | Melting Point | 283-285ºC | |
| MSDS | N/A | Flash Point | 306.5ºC | |
| Name | 2-naphthalen-2-yl-3-(2-nitroethenyl)-1H-indole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.317g/cm3 |
|---|---|
| Boiling Point | 583.2ºC at 760 mmHg |
| Melting Point | 283-285ºC |
| Molecular Formula | C20H14N2O2 |
| Molecular Weight | 314.33700 |
| Flash Point | 306.5ºC |
| Exact Mass | 314.10600 |
| PSA | 61.61000 |
| LogP | 5.75870 |
| Index of Refraction | 1.76 |
| InChIKey | HFTNZWSUCMVIGY-VAWYXSNFSA-N |
| SMILES | O=[N+]([O-])C=Cc1c(-c2ccc3ccccc3c2)[nH]c2ccccc12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-(2-Naphthyl)-3-(2-nitrovinyl)-indol |
| 2-(2-NAPHTHYL)-3-(2-NITROVINYL)INDOLE |
| 2-(Naphth-2-yl)-3-(2-nitroethenyl)indole |
| 2-(2-naphthyl)-3-(2-nitrovinyl)-1H-indole |
| 2-naphthalen-2-yl-3-(2-nitro-vinyl)-indole |