tri-O-acetyl-5-O-trityl-D-ribofuranose structure
|
Common Name | tri-O-acetyl-5-O-trityl-D-ribofuranose | ||
|---|---|---|---|---|
| CAS Number | 94482-37-8 | Molecular Weight | 518.55400 | |
| Density | 1.26g/cm3 | Boiling Point | 596.6ºC at 760mmHg | |
| Molecular Formula | C30H30O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 251.4ºC | |
| Name | [(2R,3R,4R)-4,5-diacetyloxy-2-(trityloxymethyl)oxolan-3-yl] acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 596.6ºC at 760mmHg |
| Molecular Formula | C30H30O8 |
| Molecular Weight | 518.55400 |
| Flash Point | 251.4ºC |
| Exact Mass | 518.19400 |
| PSA | 97.36000 |
| LogP | 4.14650 |
| Index of Refraction | 1.593 |
| InChIKey | VSTZPGHVUIYDQE-QSVYOFFDSA-N |
| SMILES | CC(=O)OC1OC(COC(c2ccccc2)(c2ccccc2)c2ccccc2)C(OC(C)=O)C1OC(C)=O |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| EINECS 305-401-7 |
| 5-O-triphenylmethyl-D-ribofuranose-1,2,3-triacetate |
| Tri-O-acetyl-5-O-trityl-D-ribofuranose |