methyl (E)-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enoate structure
|
Common Name | methyl (E)-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enoate | ||
|---|---|---|---|---|
| CAS Number | 945029-05-0 | Molecular Weight | 202.20900 | |
| Density | 1.295g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O2 | Melting Point | 192-193ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl (E)-3-(1H-pyrrolo[2,3-b]pyridin-5-yl)prop-2-enoate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.295g/cm3 |
|---|---|
| Melting Point | 192-193ºC |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.20900 |
| Exact Mass | 202.07400 |
| PSA | 54.98000 |
| LogP | 1.74910 |
| Index of Refraction | 1.679 |
| InChIKey | SWDITGRTPKJPDC-NSCUHMNNSA-N |
| SMILES | COC(=O)C=Cc1cnc2[nH]ccc2c1 |
| Hazard Codes | Xi |
|---|---|
| RIDADR | NONH for all modes of transport |
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-(1H-Pyrrolo[2,3-b]pyridin-5-yl)-acrylic acid methyl ester |
| A-6738 |