Tomaymycin DM structure
|
Common Name | Tomaymycin DM | ||
|---|---|---|---|---|
| CAS Number | 945490-09-5 | Molecular Weight | 258.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H14N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tomaymycin DMTomaymycin DM, a DNA alkylator, is a derivative of Tomaymycin, it is a PBD dimer, which is attached to tumor targeting antibodies to create antibody-drug conjugates (ADCs). |
| Name | Tomaymycin DM |
|---|
| Description | Tomaymycin DM, a DNA alkylator, is a derivative of Tomaymycin, it is a PBD dimer, which is attached to tumor targeting antibodies to create antibody-drug conjugates (ADCs). |
|---|---|
| Related Catalog | |
| Target |
Pyrrolobenzodiazepines |
| References |
| Molecular Formula | C14H14N2O3 |
|---|---|
| Molecular Weight | 258.27 |
| InChIKey | GXKVYHPROGIVCL-VIFPVBQESA-N |
| SMILES | C=C1CC2C=Nc3cc(O)c(OC)cc3C(=O)N2C1 |