2-Bromo-3-fluoro-5-nitrophenol structure
|
Common Name | 2-Bromo-3-fluoro-5-nitrophenol | ||
|---|---|---|---|---|
| CAS Number | 945971-14-2 | Molecular Weight | 235.995 | |
| Density | 2.0±0.1 g/cm3 | Boiling Point | 283.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C6H3BrFNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 125.4±27.3 °C | |
| Name | 2-bromo-3-fluoro-5-nitrophenol |
|---|---|
| Synonym | More Synonyms |
| Density | 2.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 283.7±40.0 °C at 760 mmHg |
| Molecular Formula | C6H3BrFNO3 |
| Molecular Weight | 235.995 |
| Flash Point | 125.4±27.3 °C |
| Exact Mass | 234.928024 |
| PSA | 66.05000 |
| LogP | 3.01 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.623 |
| InChIKey | FMNRJMOKCKSPRL-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(O)c(Br)c(F)c1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2908999090 |
| HS Code | 2908999090 |
|---|---|
| Summary | 2908999090 halogenated, sulphonated, nitrated or nitrosated derivatives of phenols or phenol-alcohols。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
| Phenol, 2-bromo-3-fluoro-5-nitro- |
| 2-Bromo-3-fluoro-5-nitrophenol |