2,7-dimethoxybicyclo[4.4.1]undeca-1,3,5,7,9-pentaene structure
|
Common Name | 2,7-dimethoxybicyclo[4.4.1]undeca-1,3,5,7,9-pentaene | ||
|---|---|---|---|---|
| CAS Number | 94632-73-2 | Molecular Weight | 202.24900 | |
| Density | 1.09g/cm3 | Boiling Point | 421.3ºC at 760 mmHg | |
| Molecular Formula | C13H14O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 190.2ºC | |
| Name | 2,7-dimethoxybicyclo[4.4.1]undeca-1,3,5,7,9-pentaene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.09g/cm3 |
|---|---|
| Boiling Point | 421.3ºC at 760 mmHg |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 202.24900 |
| Flash Point | 190.2ºC |
| Exact Mass | 202.09900 |
| PSA | 18.46000 |
| LogP | 2.73240 |
| Index of Refraction | 1.567 |
| InChIKey | CCJHTIMTDUTUEE-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC2=C(OC)C=CC=C1C2 |
|
~11%
2,7-dimethoxybi... CAS#:94632-73-2 |
| Literature: De Farias Dias, Aderson; Helwig, Thomas; Lex, Johann; Miller, Joseph; Schmickler, Hans Journal of the Chemical Society, Perkin Transactions 1, 2000 , # 13 p. 2083 - 2089 |
| 2,7-Dimethoxy-1,6-methano[10]annulene |