Capsiconiate(solution) structure
|
Common Name | Capsiconiate(solution) | ||
|---|---|---|---|---|
| CAS Number | 946572-73-2 | Molecular Weight | 332.43 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 472.2±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H28O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 159.6±22.2 °C | |
Use of Capsiconiate(solution)Capsiconiate (Coniferyl (E)-8-methyl-6-nonenoate) is a TRPV1 agonist (EC50= 3.2 μM). Capsiconiate can be used to study TRPV1-mediated diseases such as pain, inflammation, and epilepsy(EC50= 3.2 μM)[1]. |
| Name | Capsiconiate(solution) |
|---|---|
| Synonym | More Synonyms |
| Description | Capsiconiate (Coniferyl (E)-8-methyl-6-nonenoate) is a TRPV1 agonist (EC50= 3.2 μM). Capsiconiate can be used to study TRPV1-mediated diseases such as pain, inflammation, and epilepsy(EC50= 3.2 μM)[1]. |
|---|---|
| Related Catalog | |
| Target |
EC50: 3.2 μM (TRPV1)[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 472.2±45.0 °C at 760 mmHg |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.43 |
| Flash Point | 159.6±22.2 °C |
| Exact Mass | 332.198761 |
| LogP | 5.46 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | ZEWSMOFWZCBFSU-OAMUUVBCSA-N |
| SMILES | COc1cc(C=CCOC(=O)CCCCC=CC(C)C)ccc1O |
| capsiconiate |
| (2E)-3-(4-Hydroxy-3-methoxyphenyl)-2-propen-1-yl (6E)-8-methyl-6-nonenoate |
| 6-Nonenoic acid, 8-methyl-, (2E)-3-(4-hydroxy-3-methoxyphenyl)-2-propen-1-yl ester, (6E)- |