[2-(Methylamino)-5-nitrophenyl]methanol structure
|
Common Name | [2-(Methylamino)-5-nitrophenyl]methanol | ||
|---|---|---|---|---|
| CAS Number | 946582-41-8 | Molecular Weight | 182.17700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C8H10N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | [2-(Methylamino)-5-nitrophenyl]methanol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C8H10N2O3 |
|---|---|
| Molecular Weight | 182.17700 |
| Exact Mass | 182.06900 |
| PSA | 78.08000 |
| LogP | 1.72500 |
| InChIKey | YGERWDZJRVNQSX-UHFFFAOYSA-N |
| SMILES | CNc1ccc([N+](=O)[O-])cc1CO |
| HS Code | 2922199090 |
|---|
|
~%
[2-(Methylamino... CAS#:946582-41-8 |
| Literature: PFIZER PRODUCTS INC. Patent: WO2007/93904 A1, 2007 ; Location in patent: Page/Page column 21 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2-(methylamino)-5-nitrophenyl)methanol |
| Phosphine,diphenyl[2-[(2,4,6-trimethylphenyl)thio]ethyl] |
| (2-(mesitylthio)ethyl)diphenylphosphine |