5-methyl-2-(4-methylpiperazin-1-yl)aniline structure
|
Common Name | 5-methyl-2-(4-methylpiperazin-1-yl)aniline | ||
|---|---|---|---|---|
| CAS Number | 946731-22-2 | Molecular Weight | 205.29900 | |
| Density | 1.073g/cm3 | Boiling Point | 350.5ºC at 760 mmHg | |
| Molecular Formula | C12H19N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.4ºC | |
| Name | 5-methyl-2-(4-methylpiperazin-1-yl)aniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.073g/cm3 |
|---|---|
| Boiling Point | 350.5ºC at 760 mmHg |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.29900 |
| Flash Point | 163.4ºC |
| Exact Mass | 205.15800 |
| PSA | 32.50000 |
| LogP | 1.91310 |
| Index of Refraction | 1.581 |
| InChIKey | MDPCCBRUVCKNEY-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2CCN(C)CC2)c(N)c1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-methyl-2-(4-methyl-1-piperazinyl)aniline |