5,6-O-Isopropylidene-L-gulono-1,4-lactone structure
|
Common Name | 5,6-O-Isopropylidene-L-gulono-1,4-lactone | ||
|---|---|---|---|---|
| CAS Number | 94697-68-4 | Molecular Weight | 218.20400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H14O6 | Melting Point | 166-170ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4S,5S)-5-(2,2-dimethyl-1,3-dioxolan-4-yl)-3,4-dihydroxyoxolan-2-one |
|---|---|
| Synonym | More Synonyms |
| Melting Point | 166-170ºC |
|---|---|
| Molecular Formula | C9H14O6 |
| Molecular Weight | 218.20400 |
| Exact Mass | 218.07900 |
| PSA | 85.22000 |
| Index of Refraction | 1.536 |
| InChIKey | JNTPPVKRHGNFKM-BNHYGAARSA-N |
| SMILES | CC1(C)OCC(C2OC(=O)C(O)C2O)O1 |
| Safety Phrases | 22-24/25 |
|---|---|
| WGK Germany | 3 |
| HS Code | 2932999099 |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| L-5,6-isopropylidene-gulono-1,4-lactone |
| 5,6-O-Isopropylidene-L-gulono-1,4-lactone |