4-(2-Hydroxy-5-methylphenylazo)acetanilide-d3, N-[4-(2-Hydroxy-5-methylphenylazo)phenyl]acetamide-d3 structure
|
Common Name | 4-(2-Hydroxy-5-methylphenylazo)acetanilide-d3, N-[4-(2-Hydroxy-5-methylphenylazo)phenyl]acetamide-d3 | ||
|---|---|---|---|---|
| CAS Number | 947601-96-9 | Molecular Weight | 272.31700 | |
| Density | 1.21g/cm3 | Boiling Point | 533.9ºC at 760 mmHg | |
| Molecular Formula | C15H12D3N3O2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 276.7ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Warning | |
| Name | 2,2,2-trideuterio-N-[4-[(2Z)-2-(3-methyl-6-oxocyclohexa-2,4-dien-1-ylidene)hydrazinyl]phenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.21g/cm3 |
|---|---|
| Boiling Point | 533.9ºC at 760 mmHg |
| Molecular Formula | C15H12D3N3O2 |
| Molecular Weight | 272.31700 |
| Flash Point | 276.7ºC |
| Exact Mass | 272.13500 |
| PSA | 77.54000 |
| LogP | 4.72390 |
| Index of Refraction | 1.604 |
| InChIKey | PXOZAFXVEWKXED-BMSJAHLVSA-N |
| SMILES | CC(=O)Nc1ccc(N=Nc2cc(C)ccc2O)cc1 |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H317-H351 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
| Hazard Codes | Xn |
| Risk Phrases | 40-43 |
| Safety Phrases | 22-36/37-46 |
| RIDADR | NONH for all modes of transport |
| Disperse Yellow 3-d3 |
| 4-(2-Hydroxy-5-methylphenylazo)acetanilide-d3 |
| N-[4-(2-Hydroxy-5-methylphenylazo)phenyl]acetamide-d3 |