5-Chloro-8-methylquinoline-3-carboxylic acid structure
|
Common Name | 5-Chloro-8-methylquinoline-3-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 948294-24-4 | Molecular Weight | 221.64000 | |
| Density | 1.406g/cm3 | Boiling Point | 396.2ºC at 760 mmHg | |
| Molecular Formula | C11H8ClNO2 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 193.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 5-Chloro-8-methylquinoline-3-carboxylic acid |
|---|
| Density | 1.406g/cm3 |
|---|---|
| Boiling Point | 396.2ºC at 760 mmHg |
| Molecular Formula | C11H8ClNO2 |
| Molecular Weight | 221.64000 |
| Flash Point | 193.4ºC |
| Exact Mass | 221.02400 |
| PSA | 50.19000 |
| LogP | 2.89480 |
| Index of Refraction | 1.669 |
| InChIKey | CMJTVPDKPRZDHT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(Cl)c2cc(C(=O)O)cnc12 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H319 |
| Precautionary Statements | P305 + P351 + P338 |
| RIDADR | NONH for all modes of transport |