2,3,4-trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol
Modify Date: 2025-08-25 11:40:56
2,3,4-trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol structure
|
Common Name | 2,3,4-trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol | ||
|---|---|---|---|---|
| CAS Number | 94888-12-7 | Molecular Weight | 427.32200 | |
| Density | 1.765g/cm3 | Boiling Point | 419.5ºC at 760mmHg | |
| Molecular Formula | C12H3Cl7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.5ºC | |
| Name | 2,3,4-trichloro-6-(2,3,4,6-tetrachlorophenoxy)phenol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.765g/cm3 |
|---|---|
| Boiling Point | 419.5ºC at 760mmHg |
| Molecular Formula | C12H3Cl7O2 |
| Molecular Weight | 427.32200 |
| Flash Point | 207.5ºC |
| Exact Mass | 423.79500 |
| PSA | 29.46000 |
| LogP | 7.75830 |
| Index of Refraction | 1.655 |
| InChIKey | IIGANKVUIOUWRI-UHFFFAOYSA-N |
| SMILES | Oc1c(Oc2c(Cl)cc(Cl)c(Cl)c2Cl)cc(Cl)c(Cl)c1Cl |
| HS Code | 2909500000 |
|---|
|
~66%
2,3,4-trichloro... CAS#:94888-12-7 |
| Literature: Humppi Synthesis, 1985 , vol. NO. 10, p. 919 - 924 |
|
~%
2,3,4-trichloro... CAS#:94888-12-7 |
| Literature: Humppi Synthesis, 1985 , vol. NO. 10, p. 919 - 924 |
|
~%
2,3,4-trichloro... CAS#:94888-12-7 |
| Literature: Humppi Synthesis, 1985 , vol. NO. 10, p. 919 - 924 |
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4,5,6-trichloro-2-(2,3,4,6-tetrachlorophenoxy)phenol |