4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one
4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one structure
|
Common Name | 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one | ||
|---|---|---|---|---|
| CAS Number | 94953-04-5 | Molecular Weight | 395.21300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H14INO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H14INO4S |
|---|---|
| Molecular Weight | 395.21300 |
| Exact Mass | 394.96900 |
| PSA | 72.06000 |
| LogP | 3.34830 |
| InChIKey | FELFMFNKYDESDQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N2C(=O)OCC2(C)CI)cc1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~75%
4-(iodomethyl)-... CAS#:94953-04-5 |
| Literature: Liu, Hongjun; Pan, Yuanhang; Tan, Choon-Hong Tetrahedron Letters, 2008 , vol. 49, # 28 p. 4424 - 4426 |
|
~66%
4-(iodomethyl)-... CAS#:94953-04-5 |
| Literature: Hirama, Masahiro; Iwashita, Mitsuko; Yamazaki, Yutaka; Ito, Sho Tetrahedron Letters, 1984 , vol. 25, # 43 p. 4963 - 4964 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 4-iodomethyl-4-methyl-3-tosyloxazolidin-2-one |
| 2-Oxazolidinone,4-(iodomethyl)-4-methyl-3-[(4-methylphenyl)sulfonyl] |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 94953-04-5? |
| A: Chinese name of 94953-04-5 is 94953-04-5. |
| Q: What is the SMILES notation of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one? |
| A: SMILES notation of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one is Cc1ccc(S(=O)(=O)N2C(=O)OCC2(C)CI)cc1. |
| Q: What English synonyms does 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one have? |
| A: English synonyms of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one: 4-iodomethyl-4-methyl-3-tosyloxazolidin-2-one, 2-Oxazolidinone,4-(iodomethyl)-4-methyl-3-[(4-methylphenyl)sulfonyl]. |
| Q: What is the InChIKey of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one? |
| A: InChIKey of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one is FELFMFNKYDESDQ-UHFFFAOYSA-N. |
| Q: What is the English name of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one? |
| A: The English name of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one is 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one. |
| Q: What is the polar surface area (PSA) of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one? |
| A: Polar surface area (PSA) of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one is 72.06000. |
| Q: What is the molecular weight of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one? |
| A: Molecular weight of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one is 395.21300. |
| Q: What is the LogP of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one? |
| A: LogP of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one is 3.34830. |
| Q: What is the molecular formula of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one? |
| A: Molecular formula of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one is C12H14INO4S. |
| Q: What is the CAS number of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one? |
| A: CAS number of 4-(iodomethyl)-4-methyl-3-(4-methylphenyl)sulfonyl-1,3-oxazolidin-2-one is 94953-04-5. |