Methidathion structure
|
Common Name | Methidathion | ||
|---|---|---|---|---|
| CAS Number | 950-37-8 | Molecular Weight | 302.331 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 347.7±52.0 °C at 760 mmHg | |
| Molecular Formula | C6H11N2O4PS3 | Melting Point | 39-40°C | |
| MSDS | Chinese USA | Flash Point | 164.1±30.7 °C | |
| Symbol |
GHS05, GHS06, GHS09 |
Signal Word | Danger | |
| Name | methidathion |
|---|---|
| Synonym | More Synonyms |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 347.7±52.0 °C at 760 mmHg |
| Melting Point | 39-40°C |
| Molecular Formula | C6H11N2O4PS3 |
| Molecular Weight | 302.331 |
| Flash Point | 164.1±30.7 °C |
| Exact Mass | 301.961853 |
| PSA | 158.02000 |
| LogP | 2.03 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | MEBQXILRKZHVCX-UHFFFAOYSA-N |
| SMILES | COc1nn(CSP(=S)(OC)OC)c(=O)s1 |
| Storage condition | 0-6°C |
| Water Solubility | 0.024 g/100 mL |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS05, GHS06, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H300 + H310 + H330-H318-H410 |
| Precautionary Statements | P260-P264-P273-P280-P284-P301 + P310 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves;type P2 (EN 143) respirator cartridges |
| Hazard Codes | T+:Verytoxic;N:Dangerous for the environment; |
| Risk Phrases | R21;R28;R50/53 |
| Safety Phrases | S22-S28-S36/37-S45-S60-S61 |
| RIDADR | UN 2811 |
| RTECS | TE2100000 |
| Packaging Group | II |
| Hazard Class | 6.1(a) |
|
~%
Methidathion CAS#:950-37-8 |
| Literature: Helvetica chimica acta, , vol. 51, # 3 p. 518 - 526 |
|
~%
Methidathion CAS#:950-37-8 |
| Literature: Helvetica Chimica Acta, , vol. 57, p. 1658 - 1675 |
|
Comparative toxicity of methidathion and glyphosate on early life stages of three amphibian species: Pelophylax ridibundus, Pseudepidalea viridis, and Xenopus laevis.
Aquat. Toxicol. 140-141 , 220-8, (2013) The assessments of pesticide toxicity on nontarget organisms have largely been focused on the determination of median lethal concentration (LC50) values using single/laboratory species. Although usefu... |
|
|
Fast agitated directly suspended droplet microextraction technique for the rapid analysis of eighteen organophosphorus pesticides in human blood.
J. Chromatogr. A. 1377 , 27-34, (2015) A new sample preparation technique named as fast agitated directly suspended droplet microextraction (FA-DSDME) was proposed as an improved version of directly suspended droplet microextraction (DSDME... |
|
|
Development of a more specific and accurate multiple reaction monitoring method based on GC-EI/MS/MS for simultaneously monitoring and determining 34 kinds of pesticides in Qianjinzhidai pills.
J. Chromatogr. B. Analyt. Technol. Biomed. Life Sci. 983-984 , 47-54, (2015) A rapid and accurate multi-residue method was developed for simultaneously monitoring and determining 34 kinds of pesticides by GC-EI/MS/MS, successfully applied in Qianjinzhidai pills. Precision, rep... |
| faat |
| Phosphorodithioic Acid S-[(5-Methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl]O,O-Dimethyl Ester |
| Phosphorodithioic acid, S-[(5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl ester |
| S-((5-methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl) O,O-dimethyl phosphorodithioate |
| Dithiophosphoric Acid O,O'-Dimethyl-S-[(2-methoxy-1,3,4-thiadiazol-5(4H)-on-4-yl)methyl] Ester |
| Geigy GS 13005 |
| S-[(5-Methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl] O,O-dimethyl phosphorodithioate |
| sphat |
| NC2964 |
| oms844 |
| O,O'-Dimethyl-S-[(2-methoxy-1,3,4-thiadiazole-5(4H)-one-4-yl)methyl] Dithiophosphate |
| S-2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-ylmethyl O,O-dimethyl phosphorodithioate |
| 3-dimethoxyphosphinothioylthiomethyl-5-methoxy-1,3,4-thiadiazol-2(3H)-one |
| Methadithion |
| dmtp |
| Phosphorodithioic Acid O,O-Dimethyl Ester S-Ester with 4-(Mercaptomethyl)-2-methoxy-D2-1,3,4-thiadiazolin-5-one |
| Somonil |
| O,O-dimethyl S-(2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-ylmethyl)phosphorodithioate |
| S-[(5-Methoxy-2-oxo-1,3,4-thiadiazol-3(2H)-yl)methyl]-O,O-dimethyldithiophosphat |
| Dithiophosphoric acid O,O'-dimethyl-S-[(5-methoxy-1,3,4-thiadiazol-2(3H)-one-3-yl)methyl] ester |
| hionate |
| MFCD00055286 |
| Methidathion |
| T5NNVSJ B1SPS&O1&O1 EO1 |
| EINECS 213-449-4 |