4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxybenzaldehyde structure
|
Common Name | 4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxybenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 950994-19-1 | Molecular Weight | 301.64800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H7ClF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[3-chloro-5-(trifluoromethyl)pyridin-2-yl]oxybenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H7ClF3NO2 |
|---|---|
| Molecular Weight | 301.64800 |
| Exact Mass | 301.01200 |
| PSA | 39.19000 |
| LogP | 4.35860 |
| InChIKey | PDNCREKLEIAJBY-UHFFFAOYSA-N |
| SMILES | O=Cc1ccc(Oc2ncc(C(F)(F)F)cc2Cl)cc1 |
| HS Code | 2933399090 |
|---|
|
~66%
4-[3-chloro-5-(... CAS#:950994-19-1 |
| Literature: Yu, Chun-Rui; Xu, Long-He; Tu, Song; Li, Zhi-Nian; Li, Bin Journal of Fluorine Chemistry, 2006 , vol. 127, # 12 p. 1540 - 1546 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-{[3-Chloro-5-(trifluoromethyl)pyridin-2-yl]oxy}benzaldehyde |