CHEMBRDG-BB 6367113 structure
|
Common Name | CHEMBRDG-BB 6367113 | ||
|---|---|---|---|---|
| CAS Number | 95184-99-9 | Molecular Weight | 218.24800 | |
| Density | 1.186g/cm3 | Boiling Point | 393.3ºC at 760 mmHg | |
| Molecular Formula | C13H14O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.3ºC | |
| Name | 7-hydroxy-8-methyl-4-propylchromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.186g/cm3 |
|---|---|
| Boiling Point | 393.3ºC at 760 mmHg |
| Molecular Formula | C13H14O3 |
| Molecular Weight | 218.24800 |
| Flash Point | 171.3ºC |
| Exact Mass | 218.09400 |
| PSA | 50.44000 |
| LogP | 2.75950 |
| Index of Refraction | 1.571 |
| InChIKey | USMHZBPZJSVWSJ-UHFFFAOYSA-N |
| SMILES | CCCc1cc(=O)oc2c(C)c(O)ccc12 |
| HS Code | 2932209090 |
|---|
|
~90%
CHEMBRDG-BB 6367113 CAS#:95184-99-9 |
| Literature: Ahluwalia; Tripathi Journal of the Indian Chemical Society, 1984 , vol. 61, # 11-12 p. 1023 - 1027 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2H-1-Benzopyran-2-one,7-hydroxy-8-methyl-4-propyl |
| 7-hydroxy-8-methyl-4-propyl-2H-1-benzopyran-2-one |
| 7-hydroxy-8-methyl-4-propyl-2H-chromen-2-one |
| 7-hydroxy-8-methyl-4-propylcoumarin |