Ethyl 3-(trifluoromethyl)picolinate
Ethyl 3-(trifluoromethyl)picolinate structure
|
Common Name | Ethyl 3-(trifluoromethyl)picolinate | ||
|---|---|---|---|---|
| CAS Number | 952182-76-2 | Molecular Weight | 219.16100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H8F3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: Ethyl 3-(trifluoromethyl)picolinate (Chinese name: 乙基3-(三氟甲基)-2-吡啶甲酸酯，CAS number: 952182-76-2)，molecular formula C9H8F3NO2，molecular weight 219.16100. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Ethyl 3-(trifluoromethyl)picolinate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H8F3NO2 |
|---|---|
| Molecular Weight | 219.16100 |
| Exact Mass | 219.05100 |
| PSA | 39.19000 |
| LogP | 2.27710 |
| InChIKey | CNITUJQBBIMJBR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1ncccc1C(F)(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ethyl 3-(trifluoromethyl)pyridine-2-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the LogP of Ethyl 3-(trifluoromethyl)picolinate? |
| A: LogP of Ethyl 3-(trifluoromethyl)picolinate is 2.27710. |
| Q: What is the SMILES notation of Ethyl 3-(trifluoromethyl)picolinate? |
| A: SMILES notation of Ethyl 3-(trifluoromethyl)picolinate is CCOC(=O)c1ncccc1C(F)(F)F. |
| Q: What is the polar surface area (PSA) of Ethyl 3-(trifluoromethyl)picolinate? |
| A: Polar surface area (PSA) of Ethyl 3-(trifluoromethyl)picolinate is 39.19000. |
| Q: What is the molecular weight of Ethyl 3-(trifluoromethyl)picolinate? |
| A: Molecular weight of Ethyl 3-(trifluoromethyl)picolinate is 219.16100. |
| Q: What is the molecular formula of Ethyl 3-(trifluoromethyl)picolinate? |
| A: Molecular formula of Ethyl 3-(trifluoromethyl)picolinate is C9H8F3NO2. |
| Q: What English synonyms does Ethyl 3-(trifluoromethyl)picolinate have? |
| A: English synonyms of Ethyl 3-(trifluoromethyl)picolinate: ethyl 3-(trifluoromethyl)pyridine-2-carboxylate. |
| Q: What is the CAS number of Ethyl 3-(trifluoromethyl)picolinate? |
| A: CAS number of Ethyl 3-(trifluoromethyl)picolinate is 952182-76-2. |
| Q: What is the InChIKey of Ethyl 3-(trifluoromethyl)picolinate? |
| A: InChIKey of Ethyl 3-(trifluoromethyl)picolinate is CNITUJQBBIMJBR-UHFFFAOYSA-N. |
| Q: What is the English name of Ethyl 3-(trifluoromethyl)picolinate? |
| A: The English name of Ethyl 3-(trifluoromethyl)picolinate is Ethyl 3-(trifluoromethyl)picolinate. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |