3-(2,3-dimethylanilino)-3-oxopropanoic acid structure
|
Common Name | 3-(2,3-dimethylanilino)-3-oxopropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 95262-02-5 | Molecular Weight | 207.22600 | |
| Density | 1.247g/cm3 | Boiling Point | 428.489ºC at 760 mmHg | |
| Molecular Formula | C11H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 212.943ºC | |
| Name | 3-(2,3-dimethylanilino)-3-oxopropanoic acid |
|---|
| Density | 1.247g/cm3 |
|---|---|
| Boiling Point | 428.489ºC at 760 mmHg |
| Molecular Formula | C11H13NO3 |
| Molecular Weight | 207.22600 |
| Flash Point | 212.943ºC |
| Exact Mass | 207.09000 |
| PSA | 66.40000 |
| LogP | 1.78960 |
| Index of Refraction | 1.594 |
| InChIKey | HGZCCNRSTVUMIA-UHFFFAOYSA-N |
| SMILES | Cc1cccc(NC(=O)CC(=O)O)c1C |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |