Cyclohexyl p-Toluenesulfonate structure
|
Common Name | Cyclohexyl p-Toluenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 953-91-3 | Molecular Weight | 254.34500 | |
| Density | 1.19g/cm3 | Boiling Point | 382.1ºC at 760 mmHg | |
| Molecular Formula | C13H18O3S | Melting Point | 45-46ºC | |
| MSDS | N/A | Flash Point | 184.9ºC | |
| Name | cyclohexyl 4-methylbenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.19g/cm3 |
|---|---|
| Boiling Point | 382.1ºC at 760 mmHg |
| Melting Point | 45-46ºC |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.34500 |
| Flash Point | 184.9ºC |
| Exact Mass | 254.09800 |
| PSA | 51.75000 |
| LogP | 4.11380 |
| Index of Refraction | 1.549 |
| InChIKey | OHHPZPDQZMUTCA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OC2CCCCC2)cc1 |
| HS Code | 2906199090 |
|---|---|
| Summary | 2906199090. cyclanic, cyclenic or cyclotherpenic alcohols. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| ((4-methylbenzenesulfonyl)oxy)cyclohexane |
| MFCD000142912 |
| cyclohexyl-p-tosylate |
| cyclohexanol tosylate |
| Cyclohexyl p-toluenesulfonate |
| Cyclohexyl toluenesulfonate |
| p-Toluenesulfonic acid,cyclohexyl ester |
| CYCLOHEXYL TOSYLATE |
| toluene-4-sulfonic acid cyclohexyl ester |
| EINECS 213-468-8 |
| Benzenesulfonic acid,4-methyl-,cyclohexyl ester |
| Tosyloxycyclohexane |