Hainanmurpanin structure
|
Common Name | Hainanmurpanin | ||
|---|---|---|---|---|
| CAS Number | 95360-22-8 | Molecular Weight | 318.32 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 485.1±45.0 °C at 760 mmHg | |
| Molecular Formula | C17H18O6 | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | 215.0±28.8 °C | |
| Symbol |
GHS05, GHS07, GHS09 |
Signal Word | Danger | |
Use of HainanmurpaninHainanmurpanin is a coumarin that can be isolated from the aerial parts of Murraya paniculata[1]. |
| Name | Hainanmurpanin |
|---|---|
| Synonym | More Synonyms |
| Description | Hainanmurpanin is a coumarin that can be isolated from the aerial parts of Murraya paniculata[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 485.1±45.0 °C at 760 mmHg |
| Molecular Formula | C17H18O6 |
| Molecular Weight | 318.32 |
| Flash Point | 215.0±28.8 °C |
| Exact Mass | 318.110352 |
| PSA | 82.81000 |
| LogP | 2.54 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.539 |
| InChIKey | VLHOVPZUSXEINR-UHFFFAOYSA-N |
| SMILES | COc1ccc2ccc(=O)oc2c1C(OC(C)=O)C(=O)C(C)C |
| Storage condition | ?20°C |
| Symbol |
GHS05, GHS07, GHS09 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H302-H318-H410 |
| Precautionary Statements | P273-P280-P305 + P351 + P338-P501 |
| Hazard Codes | Xn,N |
| Risk Phrases | 22-36-50 |
| Safety Phrases | 26-61 |
| RIDADR | UN 3077 9 / PGIII |
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
| 1-(7-Methoxy-2-oxo-2H-chromen-8-yl)-3-methyl-2-oxobutyl acetate |
| Hainanmurpanin |