4-(Vinylsulfonyl)benzoic acid structure
|
Common Name | 4-(Vinylsulfonyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 95535-40-3 | Molecular Weight | 212.222 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 438.3±37.0 °C at 760 mmHg | |
| Molecular Formula | C9H8O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.9±26.5 °C | |
| Name | 4-(Vinylsulfonyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 438.3±37.0 °C at 760 mmHg |
| Molecular Formula | C9H8O4S |
| Molecular Weight | 212.222 |
| Flash Point | 218.9±26.5 °C |
| Exact Mass | 212.014328 |
| PSA | 79.82000 |
| LogP | 1.33 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.569 |
| InChIKey | XVNBCTUERGUCCX-UHFFFAOYSA-N |
| SMILES | C=CS(=O)(=O)c1ccc(C(=O)O)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2916399090 |
|
~83%
4-(Vinylsulfony... CAS#:95535-40-3 |
| Literature: Horner, Leopold; Lindel, Hans Liebigs Annalen der Chemie, 1985 , # 1 p. 22 - 33 |
|
~%
4-(Vinylsulfony... CAS#:95535-40-3 |
| Literature: Liebigs Annalen der Chemie, , # 1 p. 22 - 33 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-ethenylsulfonylbenzoic acid |
| 4-(Vinylsulfonyl)benzoic acid |
| Benzoic acid, 4-(ethenylsulfonyl)- |