2-(4-(Dimethylamino)phenyl)thiazole-4-carboxylic acid structure
|
Common Name | 2-(4-(Dimethylamino)phenyl)thiazole-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 955400-50-7 | Molecular Weight | 248.301 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 465.4±51.0 °C at 760 mmHg | |
| Molecular Formula | C12H12N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.3±30.4 °C | |
| Name | 2-[4-(Dimethylamino)phenyl]-1,3-thiazole-4-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 465.4±51.0 °C at 760 mmHg |
| Molecular Formula | C12H12N2O2S |
| Molecular Weight | 248.301 |
| Flash Point | 235.3±30.4 °C |
| Exact Mass | 248.061951 |
| PSA | 81.67000 |
| LogP | 3.33 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | CSXUFSBJQHZIIV-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(-c2nc(C(=O)O)cs2)cc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2934100090 |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-[4-(Dimethylamino)phenyl]-1,3-thiazole-4-carboxylic acid |
| 4-Thiazolecarboxylic acid, 2-[4-(dimethylamino)phenyl]- |
| 2-(4-(Dimethylamino)phenyl)thiazole-4-carboxylic acid |
| 2-(4-Dimethylaminophenyl)-1,3-thiazole-4-carboxylic acid |