Diphenamid structure
|
Common Name | Diphenamid | ||
|---|---|---|---|---|
| CAS Number | 957-51-7 | Molecular Weight | 239.31200 | |
| Density | 1.07 g/cm3 | Boiling Point | 382.4ºC | |
| Molecular Formula | C16H17NO | Melting Point | 132-136 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 173.3ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
Use of DiphenamidDiphenamid is a chemical compound from the group of acetamides and a herbicide. The effect is based on inhibition of acetyl-CoA carboxylase. Do not confuse with anti-inflammatory agent difenpiramide. |
| Name | diphenamid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.07 g/cm3 |
|---|---|
| Boiling Point | 382.4ºC |
| Melting Point | 132-136 °C(lit.) |
| Molecular Formula | C16H17NO |
| Molecular Weight | 239.31200 |
| Flash Point | 173.3ºC |
| Exact Mass | 239.13100 |
| PSA | 20.31000 |
| LogP | 2.90670 |
| InChIKey | QAHFOPIILNICLA-UHFFFAOYSA-N |
| SMILES | CN(C)C(=O)C(c1ccccc1)c1ccccc1 |
| Storage condition | 0-6°C |
| Stability | Stable. Incompatible with strong oxidizing agents, strong bases. |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H412 |
| Precautionary Statements | P273 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | R22;R52/53 |
| Safety Phrases | 61 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | AB8050000 |
| Hazard Class | 3,6.1 |
| HS Code | 2924299037 |
| Precursor 9 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299037 |
|---|---|
| Summary | 2924299037 2-chloro-n-((4-(trifluoromethoxy)phenyl)carbamoyl)benzamide。supervision conditions:s(import or export registration certificate for pesticides)。VAT:17.0%。tax rebate rate:9.0%。MFN tarrif:6.5%。general tariff:30.0% |
|
[Toxicologic characteristics of several pesticides and standards for them in water].
Probl. Khig. 8 , 116-20, (1983) The progressive increase of production and application of chemicals for plant protection transmuted the problem of protection of water cleanliness into an international and national problem. The cases... |
|
|
Determination of diphenamide, napropamide and metolachlor in tobacco by gel permeation chromatographic clean-up and high performance liquid chromatography.
Ann. Chim. 95(5) , 369-74, (2005) Diphenamide, napropamide and metolachlor (FIG. 1) are selective, pre-emergence arylamide herbicides used to control the growth of annual grasses and broadleaf weeds in a variety of fields, e.g. fruit ... |
|
|
[Data on establishing the maximum permissible concentration of difenamid in the air of a work area].
Gig. Sanit. (5) , 77-8, (1983)
|
| DIPHENAMID |
| N,N-dimethyl-2,2-diphenyl-acetamide |
| Dymid |
| 2,2-diphenyl-N,N-dimethylacetamide |
| rideon |
| EINECS 213-482-4 |
| Dimid |
| zarur |
| u4513 |
| ENIDE |
| Fenam |
| N,N-dimethyldiphenylacetamide |
| N,N-dimethyl-2,2-diphenylacetamide |
| Dif 4 |
| MFCD00008321 |
| diphenylamide |
| N,N-dimethyl-α-phenylbenzeneacetamide |
| 80w |