2-bromo-1-[4-(trifluoromethyl)phenyl]propan-1-one structure
|
Common Name | 2-bromo-1-[4-(trifluoromethyl)phenyl]propan-1-one | ||
|---|---|---|---|---|
| CAS Number | 95728-57-7 | Molecular Weight | 281.06900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8BrF3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-bromo-1-[4-(trifluoromethyl)phenyl]propan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H8BrF3O |
|---|---|
| Molecular Weight | 281.06900 |
| Exact Mass | 279.97100 |
| PSA | 17.07000 |
| LogP | 3.67150 |
| InChIKey | NFXCMWCJLDRJIM-UHFFFAOYSA-N |
| SMILES | CC(Br)C(=O)c1ccc(C(F)(F)F)cc1 |
|
~91%
2-bromo-1-[4-(t... CAS#:95728-57-7 |
| Literature: J. Uriach and Cia. S.A. Patent: US5478826 A1, 1995 ; |
|
~%
2-bromo-1-[4-(t... CAS#:95728-57-7 |
| Literature: Kalendra, Diane M.; Sickles, Barry R. Journal of Organic Chemistry, 2003 , vol. 68, # 4 p. 1594 - 1596 |
|
~%
2-bromo-1-[4-(t... CAS#:95728-57-7 |
| Literature: Kalendra, Diane M.; Sickles, Barry R. Journal of Organic Chemistry, 2003 , vol. 68, # 4 p. 1594 - 1596 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-bromo-4'-(trifluoromethyl)propiophenone |
| 1-Propanone,2-bromo-1-[4-(trifluoromethyl)phenyl] |
| 4-(2-Bromopropanoyl)benzotrifluoride |
| PC8809 |
| 2-bromo-1-(4-trifluoromethylphenyl)propan-1-one |