4'-(Trifluoromethyl)propiophenone structure
|
Common Name | 4'-(Trifluoromethyl)propiophenone | ||
|---|---|---|---|---|
| CAS Number | 711-33-1 | Molecular Weight | 202.173 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 232.0±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H9F3O | Melting Point | 36-39 °C(lit.) | |
| MSDS | USA | Flash Point | 101.7±18.8 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 4-(Trifluoromethyl)propiophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 232.0±40.0 °C at 760 mmHg |
| Melting Point | 36-39 °C(lit.) |
| Molecular Formula | C10H9F3O |
| Molecular Weight | 202.173 |
| Flash Point | 101.7±18.8 °C |
| Exact Mass | 202.060547 |
| PSA | 17.07000 |
| LogP | 3.17 |
| Vapour Pressure | 0.1±0.5 mmHg at 25°C |
| Index of Refraction | 1.449 |
| InChIKey | QFKOWENRSZZLPK-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1ccc(C(F)(F)F)cc1 |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2914700090 |
| Precursor 9 | |
|---|---|
| DownStream 3 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 1-[4-(trifluoromethyl)phenyl]propan-1-one |
| MFCD00039231 |
| 4'-(Trifluoromethyl)propiophenone |
| FXFFR DV2 |
| p-(Trifluoromethyl)propiophenone |
| 1-[4-(Trifluoromethyl)phenyl]-1-propanone |