DPA-714 structure
|
Common Name | DPA-714 | ||
|---|---|---|---|---|
| CAS Number | 958233-07-3 | Molecular Weight | 398.474 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C22H27FN4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DPA-714DPA-714 is a high affinity translocator protein (TSPO) ligand (Ki=7 nM), which is designed with a fluorine atom in its structure, allowing labelling with fluorine -18 and in vivo imaging using positron emission tomography. [18F]DPA-714 successfully evaluates for the specific imaging of inflammation in various models of neuroinflammation and in a brain tumor model[1][2]. |
| Name | DPA-714 |
|---|---|
| Synonym | More Synonyms |
| Description | DPA-714 is a high affinity translocator protein (TSPO) ligand (Ki=7 nM), which is designed with a fluorine atom in its structure, allowing labelling with fluorine -18 and in vivo imaging using positron emission tomography. [18F]DPA-714 successfully evaluates for the specific imaging of inflammation in various models of neuroinflammation and in a brain tumor model[1][2]. |
|---|---|
| Related Catalog | |
| Target |
Ki: 7 nM (TSPO)[1] |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C22H27FN4O2 |
| Molecular Weight | 398.474 |
| Exact Mass | 398.211792 |
| LogP | 2.86 |
| Index of Refraction | 1.581 |
| InChIKey | FLZZFWBNYJNHMY-UHFFFAOYSA-N |
| SMILES | CCN(CC)C(=O)Cc1c(-c2ccc(OCCF)cc2)nn2c(C)cc(C)nc12 |
| Pyrazolo[1,5-a]pyrimidine-3-acetamide, N,N-diethyl-2-[4-(2-fluoroethoxy)phenyl]-5,7-dimethyl- |
| DPA-714 |
| N,N-Diethyl-2-{2-[4-(2-fluoroethoxy)phenyl]-5,7-dimethylpyrazolo[1,5-a]pyrimidin-3-yl}acetamide |
| Y1H4D2VKZD |