Bis(2-hydroxyethyl) Terephthalate structure
|
Common Name | Bis(2-hydroxyethyl) Terephthalate | ||
|---|---|---|---|---|
| CAS Number | 959-26-2 | Molecular Weight | 254.23600 | |
| Density | 1.315 g/cm3 | Boiling Point | 446.5ºC at 760 mmHg | |
| Molecular Formula | C12H14O6 | Melting Point | 106-109ºC | |
| MSDS | Chinese USA | Flash Point | 172ºC | |
| Name | Bis(2-hydroxyethyl) Terephthalate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.315 g/cm3 |
|---|---|
| Boiling Point | 446.5ºC at 760 mmHg |
| Melting Point | 106-109ºC |
| Molecular Formula | C12H14O6 |
| Molecular Weight | 254.23600 |
| Flash Point | 172ºC |
| Exact Mass | 254.07900 |
| PSA | 93.06000 |
| Index of Refraction | 1.552 |
| InChIKey | QPKOBORKPHRBPS-UHFFFAOYSA-N |
| SMILES | O=C(OCCO)c1ccc(C(=O)OCCO)cc1 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2918199090 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
|
Comparison of genetic structures and biochemical properties of tandem cutinase-type polyesterases from Thermobifida alba AHK119.
J. Biosci. Bioeng. 120 , 491-7, (2015) This study described the genetic map of tandem genes (est1 and est119) encoding cutinase-type polyesterases in Thermobifida alba AHK119 and comparison of wild type and mutant enzymes of Est1 and Est11... |
| EINECS 213-497-6 |
| Bis(2-hydroxyethyl) terephthalate |
| MFCD00081066 |