2,4-Bis(benzyloxy)-5-isopropylbenzaldehyde structure
|
Common Name | 2,4-Bis(benzyloxy)-5-isopropylbenzaldehyde | ||
|---|---|---|---|---|
| CAS Number | 959466-51-4 | Molecular Weight | 360.446 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 529.3±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H24O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.5±16.5 °C | |
| Name | 2,4-bis(phenylmethoxy)-5-propan-2-ylbenzaldehyde |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 529.3±50.0 °C at 760 mmHg |
| Molecular Formula | C24H24O3 |
| Molecular Weight | 360.446 |
| Flash Point | 266.5±16.5 °C |
| Exact Mass | 360.172546 |
| PSA | 35.53000 |
| LogP | 6.30 |
| Vapour Pressure | 0.0±1.4 mmHg at 25°C |
| Index of Refraction | 1.599 |
| InChIKey | SPNCDKLGLPWEGP-UHFFFAOYSA-N |
| SMILES | CC(C)c1cc(C=O)c(OCc2ccccc2)cc1OCc1ccccc1 |
| HS Code | 2912499000 |
|---|
|
~%
2,4-Bis(benzylo... CAS#:959466-51-4 |
| Literature: SYNTA PHARMACEUTICALS CORP. Patent: WO2008/57246 A2, 2008 ; Location in patent: Page/Page column 275 ; |
|
~86%
2,4-Bis(benzylo... CAS#:959466-51-4 |
| Literature: TOPOTARGET A/S Patent: WO2009/66060 A2, 2009 ; Location in patent: Page/Page column 116 ; WO 2009/066060 A2 |
| HS Code | 2912499000 |
|---|---|
| Summary | 2912499000. other aldehyde-ethers, aldehyde-phenols and aldehydes with other oxygen function. VAT:17.0%. Tax rebate rate:9.0%. . MFN tariff:5.5%. General tariff:30.0% |
| Benzaldehyde, 5-(1-methylethyl)-2,4-bis(phenylmethoxy)- |
| 2,4-bis-benzyloxy-5-isopropyl-benzaldehyde |
| 2,4-Bis(benzyloxy)-5-isopropylbenzaldehyde |
| QC-4984 |